For research use only. Not for therapeutic Use.
3-Azetidinecarboxylic acid, methyl ester, hydrochloride (Cat No.:M003198) is a chemical compound containing an azetidine ring with a carboxylic acid group and a methyl ester group. It is in the form of a hydrochloride salt. Specific information on its applications and properties may be limited. Further research is necessary to determine its specific uses and characteristics.
| Catalog Number | M003198 |
| CAS Number | 100202-39-9 |
| Molecular Formula | C5H10ClNO2 |
| Purity | ≥95% |
| Target | PROTAC |
| Storage | RT |
| IUPAC Name | methyl azetidine-3-carboxylate;hydrochloride |
| InChI | InChI=1S/C5H9NO2.ClH/c1-8-5(7)4-2-6-3-4;/h4,6H,2-3H2,1H3;1H |
| InChIKey | UOCWTLBPYROHEF-UHFFFAOYSA-N |
| SMILES | COC(=O)C1CNC1.Cl |
