For research use only. Not for therapeutic Use.
3′-Azido-3′-deoxyadenosine (Cat No.:I041321) is a nucleoside analog that has shown potential as an antiviral and anticancer agent. It functions by inhibiting the replication of viral DNA and RNA through incorporation into the nucleic acid chains, where it disrupts normal nucleic acid synthesis. The azido group at the 3′ position prevents further chain elongation, rendering the virus or cancer cell unable to replicate. Preclinical studies suggest 3′-Azido-3′-deoxyadenosine could be effective in treating viral infections like HIV and certain cancers, although further clinical trials are required.
CAS Number | 58699-62-0 |
Synonyms | (2R,4R,5S)-2-(6-aminopurin-9-yl)-4-azido-5-(hydroxymethyl)oxolan-3-ol |
Molecular Formula | C10H12N8O3 |
Purity | ≥95% |
IUPAC Name | (2R,3R,4S,5S)-2-(6-aminopurin-9-yl)-4-azido-5-(hydroxymethyl)oxolan-3-ol |
InChI | InChI=1S/C10H12N8O3/c11-8-6-9(14-2-13-8)18(3-15-6)10-7(20)5(16-17-12)4(1-19)21-10/h2-5,7,10,19-20H,1H2,(H2,11,13,14)/t4-,5-,7-,10-/m1/s1 |
InChIKey | HTWSTKVLFZRAPM-QYYRPYCUSA-N |
SMILES | C1=NC(=C2C(=N1)N(C=N2)[C@H]3[C@@H]([C@@H]([C@H](O3)CO)N=[N+]=[N-])O)N |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |