For research use only. Not for therapeutic Use.
3-Azidotyrosine(Cat No.:M106066) is a modified amino acid derivative, structurally similar to tyrosine but with an azido group attached at the 3-position of the aromatic ring. This unique substitution introduces a highly reactive azide functional group, which can participate in click chemistry reactions—a modern synthetic method that allows for efficient, reliable, and orthogonal coupling of molecules under mild conditions. 3-Azidotyrosine is especially useful in bioconjugation and labeling studies in peptides and proteins, enabling the specific tagging of molecules for tracking, imaging, or therapeutic targeting in biochemical and medical research applications.
CAS Number | 129960-90-3 |
Synonyms | 3-azidotyrosine |
Molecular Formula | C9H10N4O3 |
Purity | ≥95% |
Target | ADC Linker |
Storage | Desiccate at -20C |
IUPAC Name | (2S)-2-amino-3-(3-azido-4-hydroxyphenyl)propanoic acid |
InChI | InChI=1S/C9H10N4O3/c10-6(9(15)16)3-5-1-2-8(14)7(4-5)12-13-11/h1-2,4,6,14H,3,10H2,(H,15,16)/t6-/m0/s1 |
InChIKey | VGCRDUSYLLNJSS-LURJTMIESA-N |
SMILES | C1=CC(=C(C=C1CC(C(=O)O)N)N=[N+]=[N-])O |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |