For research use only. Not for therapeutic Use.
3-Benzyl-3-azabicyclo[3.1.1]heptan-2-one(CAT: L025629) is a versatile bicyclic compound used in advanced pharmaceutical and chemical research. Featuring a unique structure, it serves as a key building block for the synthesis of biologically active molecules, particularly in drug discovery and development. Its rigid bicyclo[3.1.1] framework and benzyl substitution offer distinctive reactivity, making it suitable for creating diverse chemical scaffolds. With high purity and consistent quality, this compound is ideal for exploring structure-activity relationships, medicinal chemistry, and the design of novel therapeutic agents. 3-Benzyl-3-azabicyclo[3.1.1]heptan-2-one supports innovative research in molecular pharmacology and synthetic organic chemistry.
CAS Number | 1352925-73-5 |
Molecular Formula | C13H15NO |
Purity | ≥95% |
IUPAC Name | 3-benzyl-3-azabicyclo[3.1.1]heptan-2-one |
InChI | InChI=1S/C13H15NO/c15-13-12-6-11(7-12)9-14(13)8-10-4-2-1-3-5-10/h1-5,11-12H,6-9H2 |
InChIKey | ZVTFKRPHPDTFOT-UHFFFAOYSA-N |
SMILES | C1C2CC1C(=O)N(C2)CC3=CC=CC=C3 |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |