For research use only. Not for therapeutic Use.
3-Benzyl-3-azabicyclo[3.2.1]octan-8-one(Cat No.:L015127)is a bicyclic compound used in pharmaceutical research and organic synthesis. The structure features a bridged bicyclic octane ring system with a nitrogen atom (azabicyclo) and a ketone group at the 8-position, along with a benzyl group attached to the 3-position. This compound is valuable as an intermediate in the synthesis of complex molecules, particularly in the development of pharmaceuticals, where its rigid structure and functional groups contribute to specific biological activities. It is essential for researchers focused on drug discovery, medicinal chemistry, and the creation of advanced therapeutic agents.
CAS Number | 83507-33-9 |
Molecular Formula | C14H17NO |
Purity | ≥95% |
IUPAC Name | 3-benzyl-3-azabicyclo[3.2.1]octan-8-one |
InChI | InChI=1S/C14H17NO/c16-14-12-6-7-13(14)10-15(9-12)8-11-4-2-1-3-5-11/h1-5,12-13H,6-10H2 |
InChIKey | DCDAOVIVXGHHHU-UHFFFAOYSA-N |
SMILES | C1CC2CN(CC1C2=O)CC3=CC=CC=C3 |