Home
>
Chemical Reagents>Heterocyclic Building Blocks> 3-Benzyl-9,9-dimethoxy-3-azabicyclo[3.3.1]nonane
For research use only. Not for therapeutic Use.
3-Benzyl-9,9-dimethoxy-3-azabicyclo[3.3.1]nonane(Cat No.:L007705), is a chemical compound featuring a bicyclic nonane ring system with a benzyl group and two methoxy groups attached to nitrogen atoms. This specific molecular structure is significant in medicinal chemistry and organic synthesis. Researchers utilize it as a scaffold for the design and synthesis of potential bioactive compounds. Its unique bicyclic structure makes it valuable for the development of novel drugs and molecular probes.
CAS Number | 1000931-10-1 |
Molecular Formula | C17H25NO2 |
Purity | ≥95% |
Storage | 2-8°C |
IUPAC Name | 3-benzyl-9,9-dimethoxy-3-azabicyclo[3.3.1]nonane |
InChI | InChI=1S/C17H25NO2/c1-19-17(20-2)15-9-6-10-16(17)13-18(12-15)11-14-7-4-3-5-8-14/h3-5,7-8,15-16H,6,9-13H2,1-2H3 |
InChIKey | UQUYBDDFLUHQSM-UHFFFAOYSA-N |
SMILES | COC1(C2CCCC1CN(C2)CC3=CC=CC=C3)OC |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |