For research use only. Not for therapeutic Use.
3-{benzyl[(9H-fluoren-9-ylmethoxy)carbonyl]amino}(Cat No.:L007164), features a complex structure. It includes a fluorene moiety with a benzyl group attached to a carbonyl group, which is further linked to an amino group. This compound is of interest in organic synthesis and drug discovery research. Its unique structure suggests potential applications in medicinal chemistry, potentially serving as a key intermediate for the synthesis of biologically active molecules, including pharmaceuticals. Researchers employ it as a versatile scaffold for the development of novel compounds, contributing to the advancement of drug discovery and the creation of specialized organic molecules for various applications.
CAS Number | 1935651-78-7 |
Molecular Formula | C25H23NO4 |
Purity | ≥95% |
IUPAC Name | 3-[benzyl(9H-fluoren-9-ylmethoxycarbonyl)amino]propanoic acid |
InChI | InChI=1S/C25H23NO4/c27-24(28)14-15-26(16-18-8-2-1-3-9-18)25(29)30-17-23-21-12-6-4-10-19(21)20-11-5-7-13-22(20)23/h1-13,23H,14-17H2,(H,27,28) |
InChIKey | JJELJPVKEUHQSD-UHFFFAOYSA-N |
SMILES | C1=CC=C(C=C1)CN(CCC(=O)O)C(=O)OCC2C3=CC=CC=C3C4=CC=CC=C24 |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |