For research use only. Not for therapeutic Use.
3-Benzylidene-dihydro-furan-2-one(Cat No.:L002236)is a furan derivative characterized by a benzylidene group attached at the third position, enhancing its chemical reactivity and photophysical properties. This compound is used in organic synthesis, particularly in the formation of polymers and small molecule drugs. Its conjugated system, involving a double bond and a lactone ring, makes it a useful intermediate in the synthesis of aromatic compounds and in facilitating Michael addition reactions. 3-Benzylidene-dihydro-furan-2-one is valued for its potential in creating materials with specific optical properties and in pharmaceutical development, particularly in designing anti-inflammatory and antimicrobial agents.
CAS Number | 30959-91-2 |
Molecular Formula | C11H10O2 |
Purity | ≥95% |
IUPAC Name | (3E)-3-benzylideneoxolan-2-one |
InChI | InChI=1S/C11H10O2/c12-11-10(6-7-13-11)8-9-4-2-1-3-5-9/h1-5,8H,6-7H2/b10-8+ |
InChIKey | TWDMVZSYTMJVEK-CSKARUKUSA-N |
SMILES | C1COC(=O)C1=CC2=CC=CC=C2 |