For research use only. Not for therapeutic Use.
3-(Benzyloxy)cyclobutanone (Cat No.:R061391) is a chemical compound. It consists of a cyclobutanone ring substituted with a benzyloxy group. This compound is significant in organic synthesis and chemical research due to its potential applications in various reactions. Cyclobutanone derivatives are valuable intermediates in the synthesis of complex molecules, including pharmaceuticals and natural products. The presence of a benzyloxy group adds versatility and reactivity to the compound. 3-(Benzyloxy)cyclobutanone’s role as a synthetic intermediate contributes to the construction of diverse structures, supporting advancements in drug discovery, materials science, and other chemical industries.
| Catalog Number | R061391 |
| CAS Number | 30830-27-4 |
| Synonyms | 3-(Phenylmethoxy)cyclobutan-1-one; 3-Benzyloxycyclobutan-1-one; 3-Benzyloxycyclobutanone |
| Molecular Formula | C11H12O2 |
| Purity | ≥95% |
| Storage | -20°C |
| IUPAC Name | 3-phenylmethoxycyclobutan-1-one |
| InChI | InChI=1S/C11H12O2/c12-10-6-11(7-10)13-8-9-4-2-1-3-5-9/h1-5,11H,6-8H2 |
| InChIKey | GPPSQLLIFNWNSB-UHFFFAOYSA-N |
| SMILES | C1C(CC1=O)OCC2=CC=CC=C2 |
