Home
>
Chemical Reagents>Organometallic Reagents> (3-(((Benzyloxy)carbonyl)amino)-4,5-difluorophenyl)boronic acid
For research use only. Not for therapeutic Use.
(3-(((Benzyloxy)carbonyl)amino)-4,5-difluorophenyl)boronic acid(CAT: L000522) is a chemically significant compound with applications primarily in pharmaceutical and organic chemistry. Its action method involves its role as a valuable intermediate for the synthesis of diverse compounds. In pharmaceutical chemistry, it serves as a crucial building block for the development of potential drug candidates and bioactive molecules due to its specific structure and the presence of a boronic acid group, which is essential for various coupling reactions.
CAS Number | 2377609-82-8 |
Molecular Formula | C14H12BF2NO4 |
Purity | ≥95% |
IUPAC Name | [3,4-difluoro-5-(phenylmethoxycarbonylamino)phenyl]boronic acid |
InChI | InChI=1S/C14H12BF2NO4/c16-11-6-10(15(20)21)7-12(13(11)17)18-14(19)22-8-9-4-2-1-3-5-9/h1-7,20-21H,8H2,(H,18,19) |
InChIKey | WPJPJGBXFZDYNR-UHFFFAOYSA-N |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |