Home
>
Chemical Reagents>Organic Building Blocks> 3-(((Benzyloxy)carbonyl)amino)-5-methylhexanoic acid
For research use only. Not for therapeutic Use.
3-(((Benzyloxy)carbonyl)amino)-5-methylhexanoic acid is an amino acid derivative characterized by a hexanoic acid backbone with a benzyloxycarbonyl (Z) group attached to the amino group at the 3-position, and a methyl group at the 5-position. This compound exhibits enhanced stability and reactivity, making it useful in peptide synthesis and medicinal chemistry. The benzyloxycarbonyl protecting group can facilitate the formation of peptide bonds, while the unique structure allows for further modifications, supporting the exploration of structure-activity relationships in drug development.
CAS Number | 1311254-63-3 |
Molecular Formula | C15H21NO4 |
Purity | ≥95% |
IUPAC Name | 5-methyl-3-(phenylmethoxycarbonylamino)hexanoic acid |
InChI | InChI=1S/C15H21NO4/c1-11(2)8-13(9-14(17)18)16-15(19)20-10-12-6-4-3-5-7-12/h3-7,11,13H,8-10H2,1-2H3,(H,16,19)(H,17,18) |
InChIKey | NXDHEHGNNDPBNL-UHFFFAOYSA-N |
SMILES | CC(C)CC(CC(=O)O)NC(=O)OCC1=CC=CC=C1 |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |