For research use only. Not for therapeutic Use.
3-(Benzyloxy)cyclobutanol is a functionalized cyclobutane derivative commonly used in synthetic and medicinal chemistry. Featuring a benzyloxy group attached to a cyclobutanol framework, this compound provides a stable yet reactive structure useful for constructing complex molecular architectures. It serves as an intermediate in the synthesis of bioactive compounds, supporting modifications that enhance molecular interactions and stability. Its applications extend to pharmaceutical research, where it aids in the development of drug candidates and in the exploration of novel therapeutic compounds.
| Catalog Number | L034761 |
| CAS Number | 233276-35-2 |
| Molecular Formula | C11H14O2 |
| Purity | ≥95% |
| IUPAC Name | 3-phenylmethoxycyclobutan-1-ol |
| InChI | InChI=1S/C11H14O2/c12-10-6-11(7-10)13-8-9-4-2-1-3-5-9/h1-5,10-12H,6-8H2 |
| InChIKey | ZGSDRBWWICYJBU-UHFFFAOYSA-N |
| SMILES | C1C(CC1OCC2=CC=CC=C2)O |
