For research use only. Not for therapeutic Use.
3-(BOC-Amino)benzaldehyde is a benzaldehyde derivative featuring a tert-butyloxycarbonyl (BOC)-protected amino group at the meta position. The BOC group protects the amine during chemical reactions, allowing selective modifications of other functional groups. This compound is commonly used in peptide synthesis and organic chemistry as an intermediate in the preparation of more complex molecules. Its structure makes it valuable in medicinal chemistry and drug development, enabling researchers to explore various synthetic pathways while maintaining control over reactivity during multistep processes.
CAS Number | 176980-36-2 |
Molecular Formula | C12H15NO3 |
Purity | ≥95% |
Storage | Store at RT |
IUPAC Name | tert-butyl N-(3-formylphenyl)carbamate |
InChI | InChI=1S/C12H15NO3/c1-12(2,3)16-11(15)13-10-6-4-5-9(7-10)8-14/h4-8H,1-3H3,(H,13,15) |
InChIKey | JEUBPGIHGQWLAJ-UHFFFAOYSA-N |
SMILES | CC(C)(C)OC(=O)NC1=CC=CC(=C1)C=O |