For research use only. Not for therapeutic Use.
3-Borono-4,5-dichlorobenzoic Acid(CAT: L021995) is a high-purity compound widely employed in pharmaceutical, organic, and materials chemistry research. This benzoic acid derivative features boronic acid and dichloro substituents, making it a versatile intermediate for Suzuki-Miyaura coupling reactions and the synthesis of complex organic molecules. Its unique structure supports applications in drug discovery, agrochemical development, and the creation of advanced materials. With excellent stability and reactivity, 3-Borono-4,5-dichlorobenzoic Acid is an essential building block for researchers seeking innovative solutions in synthetic methodologies and molecular design.
CAS Number | 2377608-98-3 |
Molecular Formula | C7H5BCl2O4 |
Purity | ≥95% |
IUPAC Name | 3-borono-4,5-dichlorobenzoic acid |
InChI | InChI=1S/C7H5BCl2O4/c9-5-2-3(7(11)12)1-4(6(5)10)8(13)14/h1-2,13-14H,(H,11,12) |
InChIKey | VREJPHQQCLSVOL-UHFFFAOYSA-N |
SMILES | B(C1=CC(=CC(=C1Cl)Cl)C(=O)O)(O)O |