For research use only. Not for therapeutic Use.
3-Borono-4,5-difluorobenzoic acid(Cat No.:L021917)is a specialized chemical compound used in advanced organic synthesis, particularly in the development of pharmaceuticals and fine chemicals. This compound features both boronic acid and difluorobenzoic acid groups, making it highly reactive and valuable for constructing complex molecular frameworks. It is often employed in Suzuki coupling reactions and other cross-coupling methods to create various active pharmaceutical ingredients (APIs) and functional materials. Its high purity and stability make it an essential tool for researchers and chemists engaged in innovative compound development and drug discovery projects.
CAS Number | 2377605-76-8 |
Molecular Formula | C7H5BF2O4 |
Purity | ≥95% |
IUPAC Name | 3-borono-4,5-difluorobenzoic acid |
InChI | InChI=1S/C7H5BF2O4/c9-5-2-3(7(11)12)1-4(6(5)10)8(13)14/h1-2,13-14H,(H,11,12) |
InChIKey | LPIWMNPBZLPGJH-UHFFFAOYSA-N |
SMILES | B(C1=CC(=CC(=C1F)F)C(=O)O)(O)O |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |