For research use only. Not for therapeutic Use.
3-Bromo-1-(4-fluorophenyl)-1H-pyrazole-5-carboxylic acid(Cat No.:L007514), is a chemical compound featuring a pyrazole ring with a carboxylic acid group at the 5th position, a 3-bromo substituent, and a 4-fluorophenyl substituent. This compound holds significance in medicinal chemistry and drug discovery. Researchers explore its unique structure and reactivity to investigate potential pharmacological activities, making it a valuable scaffold for designing new drugs.
CAS Number | 1251249-98-5 |
Molecular Formula | C10H6BrFN2O2 |
Purity | ≥95% |
IUPAC Name | 5-bromo-2-(4-fluorophenyl)pyrazole-3-carboxylic acid |
InChI | InChI=1S/C10H6BrFN2O2/c11-9-5-8(10(15)16)14(13-9)7-3-1-6(12)2-4-7/h1-5H,(H,15,16) |
InChIKey | MLNXUKVJHGFLCU-UHFFFAOYSA-N |
SMILES | C1=CC(=CC=C1N2C(=CC(=N2)Br)C(=O)O)F |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |