Home
>
Isotope Labeled Compounds>Other Isotope Labeled Compounds> 3-Bromo-1-propan-1,1,2,2,3,3-d6-ol
For research use only. Not for therapeutic Use.
3-Bromo-1-propan-1,1,2,2,3,3-d6-ol(Cat No.:R034525) is a deuterated compound of 3-Bromo-1-propanol, featuring six deuterium atoms, significantly enhancing its molecular stability and analytical detectability. This isotopic enrichment makes it particularly useful in nuclear magnetic resonance (NMR) spectroscopy and other advanced analytical techniques. It is reliable for studying reaction mechanisms, especially in synthetic chemistry and pharmaceutical research. By offering enhanced accuracy in tracing chemical interactions, 3-Bromo-1-propan-1,1,2,2,3,3-d6-ol is crucial for researchers focusing on developing and analyzing new chemical entities and therapeutic agents.
CAS Number | 284474-43-7 |
Synonyms | 3-Bromo-1-propanol-d6; 1-Bromo-3-hydroxypropane-d6; 1-Bromo-3-propanol-d6; 3-Bromopropane-1-ol-d6; 3-Bromopropyl Alcohol-d6; 3-Hydroxypropyl Bromide; Trimethylene Bromohydrin-d6; |
Molecular Formula | C3H7BrO |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | 3-bromo-1,1,2,2,3,3-hexadeuteriopropan-1-ol |
InChI | InChI=1S/C3H7BrO/c4-2-1-3-5/h5H,1-3H2/i1D2,2D2,3D2 |
InChIKey | RQFUZUMFPRMVDX-NMFSSPJFSA-N |
SMILES | [2H]C([2H])(C([2H])([2H])O)C([2H])([2H])Br |