For research use only. Not for therapeutic Use.
3′-Bromo-[1,1′-biphenyl]-4-carbaldehyde(CAT: L039827) is a biphenyl derivative featuring a bromine atom at the 3′-position of one phenyl ring and a formyl (-CHO) group at the 4-position of the other. This compound is widely used in organic synthesis, especially in the construction of more complex molecules, including pharmaceuticals, agrochemicals, and advanced materials. The formyl group adds reactivity for further transformations, such as nucleophilic addition or condensation reactions, while the bromine atom enables coupling reactions like Suzuki-Miyaura, making it a versatile intermediate for generating carbon-carbon bonds in the development of various bioactive molecules.
CAS Number | 400749-87-3 |
Molecular Formula | C13H9BrO |
Purity | ≥95% |
IUPAC Name | 4-(3-bromophenyl)benzaldehyde |
InChI | InChI=1S/C13H9BrO/c14-13-3-1-2-12(8-13)11-6-4-10(9-15)5-7-11/h1-9H |
InChIKey | VVFSRYVBFDTNPL-UHFFFAOYSA-N |