For research use only. Not for therapeutic Use.
3-Bromo-1,1′:2′,1”-terphenyl (Cat.No:L004119) is a significant compound in organic synthesis. Its unique structure, featuring a bromine-substituted terphenyl, imparts distinct reactivity and properties. This compound is utilized as a valuable building block in the creation of specialized molecules with various applications in pharmaceutical and chemical research.
Catalog Number | L004119 |
CAS Number | 1222633-95-5 |
Molecular Formula | C18H13Br |
Purity | ≥95% |
IUPAC Name | 1-bromo-3-(2-phenylphenyl)benzene |
InChI | InChI=1S/C18H13Br/c19-16-10-6-9-15(13-16)18-12-5-4-11-17(18)14-7-2-1-3-8-14/h1-13H |
InChIKey | OONJSZCSHQXENF-UHFFFAOYSA-N |
SMILES | C1=CC=C(C=C1)C2=CC=CC=C2C3=CC(=CC=C3)Br |