For research use only. Not for therapeutic Use.
3-Bromo-1H-indazole-6-carbonitrile(Cat No.:L025044)is a heterocyclic compound commonly used in pharmaceutical research and organic synthesis. Featuring an indazole core with a bromine atom at the 3-position and a nitrile group at the 6-position, this compound serves as a valuable intermediate in the development of bioactive molecules, including potential therapeutic agents for cancer and neurological disorders. Its unique structure allows for selective chemical modifications, making it an essential building block in medicinal chemistry. Additionally, it is utilized in the synthesis of complex organic compounds and fine chemicals.
CAS Number | 1082041-50-6 |
Molecular Formula | C8H4BrN3 |
Purity | ≥95% |
IUPAC Name | 3-bromo-2H-indazole-6-carbonitrile |
InChI | InChI=1S/C8H4BrN3/c9-8-6-2-1-5(4-10)3-7(6)11-12-8/h1-3H,(H,11,12) |
InChIKey | IOYPSDOJNPATCW-UHFFFAOYSA-N |
SMILES | C1=CC2=C(NN=C2C=C1C#N)Br |