3-Bromo-2-chlorobenzonitrile

For research use only. Not for therapeutic Use.

  • CAT Number: L042158
  • CAS Number: 914250-82-1
  • Molecular Formula: C7H3BrClN
  • Molecular Weight: 216.46
  • Purity: ≥95%
Inquiry Now

3-Bromo-2-chlorobenzonitrile(Cat No.:L042158)is a crucial intermediate used in pharmaceutical and chemical research. Featuring both a bromine atom at the 3-position and a chlorine atom at the 2-position on a benzonitrile core, this compound is highly valuable for the synthesis of complex organic molecules, including potential therapeutic agents. Its unique structure allows for versatile chemical reactions, making it essential in medicinal chemistry for the development of new drugs and bioactive compounds. This compound plays a significant role in advancing research in drug discovery and organic synthesis.


CAS Number 914250-82-1
Molecular Formula C7H3BrClN
Purity ≥95%
IUPAC Name 3-bromo-2-chlorobenzonitrile
InChI InChI=1S/C7H3BrClN/c8-6-3-1-2-5(4-10)7(6)9/h1-3H
InChIKey SKSXVQHWKWTNPO-UHFFFAOYSA-N
SMILES C1=CC(=C(C(=C1)Br)Cl)C#N

Request a Quote