For research use only. Not for therapeutic Use.
3-Bromo-2-ethoxy-5-methylbenzaldehyde (Cat.No:L003588) is a key chemical compound in organic synthesis. Its distinctive structure, incorporating a bromine, ethoxy, and methyl group, offers versatile reactivity. This compound serves as a crucial intermediate in the preparation of various pharmaceutical agents and specialized materials. Its significance lies in its role as a building block for the development of innovative compounds, highlighting its importance in contemporary chemical research and drug discovery endeavors.
Catalog Number | L003588 |
CAS Number | 708272-19-9 |
Molecular Formula | C10H11BrO2 |
Purity | ≥95% |
IUPAC Name | 3-bromo-2-ethoxy-5-methylbenzaldehyde |
InChI | InChI=1S/C10H11BrO2/c1-3-13-10-8(6-12)4-7(2)5-9(10)11/h4-6H,3H2,1-2H3 |
InChIKey | NVFSURHXVOQRNU-UHFFFAOYSA-N |
SMILES | CCOC1=C(C=C(C=C1Br)C)C=O |