For research use only. Not for therapeutic Use.
3-Bromo-2-fluoro-6-methylbenzoic acid(Cat No.:L007420), is a chemical compound with the molecular formula C8H6BrFO2. This compound is a derivative of benzoic acid, substituted with bromine, fluorine, and a methyl group. Its specific applications and uses are determined by its chemical properties, which include reactivity and interactions in various chemical reactions. As a fluorinated and brominated aromatic compound, it could potentially find applications in organic synthesis, pharmaceuticals, or materials science.
CAS Number | 1427433-22-4 |
Molecular Formula | C8H6BrFO2 |
Purity | ≥95% |
Storage | Room Temperature |
IUPAC Name | 3-bromo-2-fluoro-6-methylbenzoic acid |
InChI | InChI=1S/C8H6BrFO2/c1-4-2-3-5(9)7(10)6(4)8(11)12/h2-3H,1H3,(H,11,12) |
InChIKey | UWEYXKANOPMPLE-UHFFFAOYSA-N |
SMILES | CC1=C(C(=C(C=C1)Br)F)C(=O)O |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |