For research use only. Not for therapeutic Use.
(3-Bromo-2-fluorophenyl)methanamine is an aromatic amine featuring a bromine and fluorine atom on a phenyl ring with a methanamine group. It serves as a key intermediate in organic synthesis, particularly in pharmaceutical and agrochemical research. The presence of both bromine and fluorine atoms allows for versatile chemical transformations, such as nucleophilic substitution or cross-coupling reactions. This compound is valuable in the development of bioactive molecules, including potential therapeutic agents, due to its ability to be functionalized in multiple ways.
| Catalog Number | R073170 |
| CAS Number | 261723-28-8 |
| Molecular Formula | C7H7BrFN |
| Purity | ≥95% |
| IUPAC Name | (3-bromo-2-fluorophenyl)methanamine |
| InChI | InChI=1S/C7H7BrFN/c8-6-3-1-2-5(4-10)7(6)9/h1-3H,4,10H2 |
| InChIKey | BAFXXIVSWGQMMI-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)Br)F)CN |
