For research use only. Not for therapeutic Use.
3-Bromo-2-formylbenzoic acid(CAT: L018776) is a high-purity aromatic compound commonly used in pharmaceutical and chemical research. Featuring a bromine atom at the 3-position, a formyl group at the 2-position, and a carboxylic acid functionality, it serves as a versatile building block for synthesizing bioactive molecules and complex organic derivatives. Its reactive functional groups enable diverse chemical transformations, including coupling, esterification, and oxidation reactions. With consistent performance and reliability, 3-Bromo-2-formylbenzoic acid is a valuable tool for advancing research in medicinal chemistry and innovative organic synthesis.
CAS Number | 503821-93-0 |
Molecular Formula | C8H5BrO3 |
Purity | ≥95% |
IUPAC Name | 3-bromo-2-formylbenzoic acid |
InChI | InChI=1S/C8H5BrO3/c9-7-3-1-2-5(8(11)12)6(7)4-10/h1-4H,(H,11,12) |
InChIKey | VOVNLLRCBFAQGC-UHFFFAOYSA-N |
SMILES | C1=CC(=C(C(=C1)Br)C=O)C(=O)O |