For research use only. Not for therapeutic Use.
3-Bromo-2-iodobenzo[b]thiophene (Cat.No:L003655) is a significant chemical compound with diverse applications in materials science and pharmaceuticals. Its unique heterocyclic structure, containing both bromine and iodine substituents, offers a valuable scaffold for various synthetic processes. This compound is employed as a key intermediate in the preparation of specialized materials and pharmaceutical agents, underscoring its importance in contemporary chemical research and its role in the development of innovative products across industries.
CAS Number | 140898-76-6 |
Molecular Formula | C8H4BrIS |
Purity | ≥95% |
IUPAC Name | 3-bromo-2-iodo-1-benzothiophene |
InChI | InChI=1S/C8H4BrIS/c9-7-5-3-1-2-4-6(5)11-8(7)10/h1-4H |
InChIKey | CVVNUGQTAJJZGV-UHFFFAOYSA-N |
SMILES | C1=CC=C2C(=C1)C(=C(S2)I)Br |