For research use only. Not for therapeutic Use.
3′-Bromo-2-iodobenzophenone (Cat.No:L003783) is a pivotal chemical compound with diverse applications in pharmaceutical and materials science. Its unique molecular structure, featuring both bromine and iodine substituents, offers valuable reactivity for various chemical transformations. This compound serves as a crucial intermediate in the synthesis of specialized organic molecules, underscoring its significance in the development of novel pharmaceuticals and advanced materials.
CAS Number | 1421664-41-6 |
Molecular Formula | C13H8BrIO |
Purity | ≥95% |
IUPAC Name | (3-bromophenyl)-(2-iodophenyl)methanone |
InChI | InChI=1S/C13H8BrIO/c14-10-5-3-4-9(8-10)13(16)11-6-1-2-7-12(11)15/h1-8H |
InChIKey | VCSDHYXPVVIOCX-UHFFFAOYSA-N |
SMILES | C1=CC=C(C(=C1)C(=O)C2=CC(=CC=C2)Br)I |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |