For research use only. Not for therapeutic Use.
3-Bromo-2-methoxy-4-methylpyridine(Cat No.:L037373)is a halogenated pyridine derivative featuring a bromine atom at the 3-position, a methoxy group at the 2-position, and a methyl group at the 4-position. This compound is important in pharmaceutical research and organic synthesis as a versatile intermediate for the development of bioactive molecules, including potential drug candidates and agrochemicals. The bromine atom allows for further functionalization through cross-coupling reactions, while the methoxy and methyl groups enhance the compound’s reactivity and potential for diverse chemical modifications. High purity ensures its effectiveness in advanced research and medicinal chemistry applications.
CAS Number | 717843-51-1 |
Molecular Formula | C7H8BrNO |
Purity | ≥95% |
IUPAC Name | 3-bromo-2-methoxy-4-methylpyridine |
InChI | InChI=1S/C7H8BrNO/c1-5-3-4-9-7(10-2)6(5)8/h3-4H,1-2H3 |
InChIKey | UNWSCHYDURCYOR-UHFFFAOYSA-N |
SMILES | CC1=C(C(=NC=C1)OC)Br |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |