For research use only. Not for therapeutic Use.
3-Bromo-2-methylpropan-1-ol(CAT: L038395) is an organic compound featuring a bromine atom attached to a three-carbon chain with a hydroxyl (–OH) group at the 1-position and a methyl group at the 2-position. This compound is often used as an intermediate in organic synthesis, as the bromine substituent allows for various nucleophilic substitutions, while the hydroxyl group can participate in further functionalization reactions. 3-Bromo-2-methylpropan-1-ol is particularly useful in the synthesis of complex organic molecules, including pharmaceuticals and agrochemicals, where it serves as a building block for creating substituted alcohols and other functional groups. Its reactivity makes it versatile for applications in designing biologically active molecules and in material science research.
CAS Number | 40145-08-2 |
Molecular Formula | C4H9BrO |
Purity | ≥95% |
IUPAC Name | 3-bromo-2-methylpropan-1-ol |
InChI | InChI=1S/C4H9BrO/c1-4(2-5)3-6/h4,6H,2-3H2,1H3 |
InChIKey | KIBOHRIGZMLNNS-UHFFFAOYSA-N |