For research use only. Not for therapeutic Use.
3-Bromo-2-methylquinoline(CAT: L030229) is a high-purity brominated quinoline derivative, widely valued in pharmaceutical research and organic synthesis. Featuring a methyl and bromine substitution on the quinoline framework, this compound serves as a versatile building block for the development of bioactive molecules and complex chemical structures. Its unique reactivity is particularly advantageous in medicinal chemistry for the synthesis of therapeutic candidates and functional materials. With reliable stability and precise formulation, 3-Bromo-2-methylquinoline ensures consistent performance, making it an essential tool for researchers engaged in drug discovery, fine chemical production, and advanced material science.
CAS Number | 343330-62-1 |
Molecular Formula | C10H8BrN |
Purity | ≥95% |
IUPAC Name | 3-bromo-2-methylquinoline |
InChI | InChI=1S/C10H8BrN/c1-7-9(11)6-8-4-2-3-5-10(8)12-7/h2-6H,1H3 |
InChIKey | HPFGRHQVLBAAFX-UHFFFAOYSA-N |
SMILES | CC1=NC2=CC=CC=C2C=C1Br |