For research use only. Not for therapeutic Use.
3-Bromo-2-vinylpyridine(Cat No.:L035282)is a versatile intermediate used in the synthesis of advanced organic compounds, particularly in pharmaceutical and materials science research. The bromine and vinyl groups allow for a wide range of chemical transformations, making it an essential building block in developing novel therapeutic agents and polymers. Its pyridine core adds further reactivity, enabling the creation of complex molecules with potential biological activity. High purity and stability make 3-Bromo-2-vinylpyridine a reliable choice for researchers focused on drug discovery and innovative materials development.
CAS Number | 799246-56-3 |
Molecular Formula | C7H6BrN |
Purity | ≥95% |
IUPAC Name | 3-bromo-2-ethenylpyridine |
InChI | InChI=1S/C7H6BrN/c1-2-7-6(8)4-3-5-9-7/h2-5H,1H2 |
InChIKey | DOCFMUXZWGZPIM-UHFFFAOYSA-N |
SMILES | C=CC1=C(C=CC=N1)Br |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |