For research use only. Not for therapeutic Use.
3-Bromo-2,4-dimethylpyridine(CAT: L044870) is a substituted pyridine derivative commonly used as an intermediate in organic synthesis and pharmaceutical research. The structure features bromine at the 3-position and methyl groups at the 2- and 4-positions, which contribute to its reactivity and stability. The bromine atom makes this compound suitable for further functionalization through cross-coupling reactions, enabling the synthesis of more complex structures. This compound is often employed in developing molecules with potential biological activity, including antimicrobial and anti-inflammatory agents, due to the pyridine ring’s known bioactive properties. Its versatile reactivity also makes it valuable for creating heterocyclic compounds and other functionalized materials.
CAS Number | 27063-93-0 |
Molecular Formula | C7H8BrN |
Purity | ≥95% |
IUPAC Name | 3-bromo-2,4-dimethylpyridine |
InChI | InChI=1S/C7H8BrN/c1-5-3-4-9-6(2)7(5)8/h3-4H,1-2H3 |
InChIKey | HWSUJPQZGWOXFZ-UHFFFAOYSA-N |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |