For research use only. Not for therapeutic Use.
3-Bromo-2,6-dihydroxybenzoic Acid is an important chemical intermediate used in organic synthesis and pharmaceutical research. Known for its role in synthesizing bioactive molecules and complex compounds, it is essential for developing new drugs and therapeutic agents. This compound’s high purity and reactivity ensure consistent and reliable results in experimental procedures. Its applications extend to medicinal chemistry and material science, making it a valuable tool for advanced research and innovative product development in various scientific fields.
| Catalog Number | R002074 |
| CAS Number | 26792-49-4 |
| Synonyms | 3-Bromo-γ-resorcylic Acid; |
| Molecular Formula | C7H5BrO4 |
| Purity | ≥95% |
| Storage | Store at RT |
| IUPAC Name | 3-bromo-2,6-dihydroxybenzoic acid |
| InChI | InChI=1S/C7H5BrO4/c8-3-1-2-4(9)5(6(3)10)7(11)12/h1-2,9-10H,(H,11,12) |
| InChIKey | GPCLJSXGFAOJQE-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1O)C(=O)O)O)Br |
