For research use only. Not for therapeutic Use.
3-Bromo-4-chloro-5-methoxyaniline(CAT: L020843) is an aromatic amine derivative featuring bromine, chlorine, and methoxy functional groups on the benzene ring. This unique combination of substituents enhances the compound’s versatility in chemical synthesis and its potential applications in medicinal chemistry. The bromo and chloro groups offer reactive sites for further modification, making 3-Bromo-4-chloro-5-methoxyaniline a valuable intermediate in the synthesis of complex molecules, including pharmaceutical agents and agrochemicals. Its structure also lends itself to studies focused on drug metabolism and the development of biologically active compounds.
CAS Number | 940948-33-4 |
Molecular Formula | C7H7BrClNO |
Purity | ≥95% |
IUPAC Name | 3-bromo-4-chloro-5-methoxyaniline |
InChI | InChI=1S/C7H7BrClNO/c1-11-6-3-4(10)2-5(8)7(6)9/h2-3H,10H2,1H3 |
InChIKey | UTFANKZLVTVWQX-UHFFFAOYSA-N |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |