For research use only. Not for therapeutic Use.
3-Bromo-4-fluoro-1H-indazole is a heterocyclic compound characterized by an indazole ring with a bromine atom at the 3-position and a fluorine atom at the 4-position. This unique substitution pattern imparts distinct electronic properties and enhances its reactivity, making it valuable in organic synthesis and medicinal chemistry. The compound may exhibit biological activity, potentially serving as a scaffold for developing novel pharmaceuticals. Its halogenated structure allows for further modifications, facilitating exploration of structure-activity relationships in drug discovery.
CAS Number | 885521-60-8 |
Molecular Formula | C7H4BrFN2 |
Purity | ≥95% |
IUPAC Name | 3-bromo-4-fluoro-2H-indazole |
InChI | InChI=1S/C7H4BrFN2/c8-7-6-4(9)2-1-3-5(6)10-11-7/h1-3H,(H,10,11) |
InChIKey | GEWAOEJPYFYDFT-UHFFFAOYSA-N |
SMILES | C1=CC2=NNC(=C2C(=C1)F)Br |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |