For research use only. Not for therapeutic Use.
3-Bromo-4-hydroxyphenylacetic acid(Cat No.:L019198)is an aromatic compound used in organic synthesis and pharmaceutical research. The molecule features a phenylacetic acid core with a bromine atom at the 3-position and a hydroxyl group at the 4-position, offering unique reactivity. This compound is valuable as an intermediate in the synthesis of complex molecules, including potential drug candidates and fine chemicals. The presence of both the bromine and hydroxyl groups allows for versatile chemical modifications, making it essential for researchers focused on drug discovery, medicinal chemistry, and the development of advanced synthetic materials.
CAS Number | 38692-80-7 |
Molecular Formula | C8H7BrO3 |
Purity | ≥95% |
IUPAC Name | 2-(3-bromo-4-hydroxyphenyl)acetic acid |
InChI | InChI=1S/C8H7BrO3/c9-6-3-5(4-8(11)12)1-2-7(6)10/h1-3,10H,4H2,(H,11,12) |
InChIKey | BFVCOQXPSXVGPS-UHFFFAOYSA-N |
SMILES | C1=CC(=C(C=C1CC(=O)O)Br)O |