For research use only. Not for therapeutic Use.
3-Bromo-4-nitro-1H-pyrazole(Cat No.:L034392)is a halogenated and nitrated pyrazole derivative used in organic synthesis and pharmaceutical research. This compound features a bromine atom at the 3-position and a nitro group at the 4-position of the pyrazole ring, making it a highly reactive intermediate for the synthesis of complex molecules. It is particularly valuable in the development of bioactive compounds, including potential therapeutic agents and agrochemicals. With its unique combination of functional groups, 3-Bromo-4-nitro-1H-pyrazole supports advanced research in medicinal chemistry and chemical synthesis.
CAS Number | 784193-37-9 |
Molecular Formula | C3H2BrN3O2 |
Purity | ≥95% |
IUPAC Name | 5-bromo-4-nitro-1H-pyrazole |
InChI | InChI=1S/C3H2BrN3O2/c4-3-2(7(8)9)1-5-6-3/h1H,(H,5,6) |
InChIKey | XAURTANBYDETIM-UHFFFAOYSA-N |
SMILES | C1=NNC(=C1[N+](=O)[O-])Br |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |