For research use only. Not for therapeutic Use.
3-Bromo-4-propylbenzoic acid(Cat No.:L035540)is an aromatic compound featuring a bromine atom at the 3-position and a propyl group at the 4-position of a benzoic acid core. This compound is commonly used in pharmaceutical research and organic synthesis as a building block for the development of biologically active molecules and fine chemicals. Its brominated structure allows for versatile reactivity, particularly in cross-coupling reactions, making it valuable for constructing complex molecules. Researchers in medicinal chemistry utilize this compound for designing novel therapeutic agents and other advanced materials.
CAS Number | 1131615-01-4 |
Molecular Formula | C10H11BrO2 |
Purity | ≥95% |
IUPAC Name | 3-bromo-4-propylbenzoic acid |
InChI | InChI=1S/C10H11BrO2/c1-2-3-7-4-5-8(10(12)13)6-9(7)11/h4-6H,2-3H2,1H3,(H,12,13) |
InChIKey | VLXUNAMNAIRVJU-UHFFFAOYSA-N |
SMILES | CCCC1=C(C=C(C=C1)C(=O)O)Br |