For research use only. Not for therapeutic Use.
3-Bromo-5-chlorothieno[3,2-b]pyridine(Cat No.:L034029)is a high-purity heterocyclic compound essential for pharmaceutical research and organic synthesis. Featuring bromine and chlorine substituents on a thieno[3,2-b]pyridine scaffold, this compound is a valuable intermediate in the synthesis of complex organic molecules, including potential therapeutic agents. Its unique structure offers significant reactivity and versatility in medicinal chemistry, making it ideal for the development of bioactive compounds and drug candidates. This compound ensures precision and reliability in advanced research, supporting the discovery and development of innovative treatments in various therapeutic areas.
CAS Number | 912332-40-2 |
Molecular Formula | C7H3BrClNS |
Purity | ≥95% |
IUPAC Name | 3-bromo-5-chlorothieno[3,2-b]pyridine |
InChI | InChI=1S/C7H3BrClNS/c8-4-3-11-5-1-2-6(9)10-7(4)5/h1-3H |
InChIKey | QGZAMJYHCIHPCU-UHFFFAOYSA-N |
SMILES | C1=CC(=NC2=C1SC=C2Br)Cl |