For research use only. Not for therapeutic Use.
3-Bromo-5-chlorotoluene is a halogenated aromatic compound featuring both bromine and chlorine substituents on a toluene ring. This compound is used as an intermediate in organic synthesis, particularly in the production of pharmaceuticals, agrochemicals, and advanced materials. Its dual halogenation enhances its reactivity, allowing for various functionalization reactions such as cross-coupling or nucleophilic substitution. Researchers explore its applications in creating more complex molecules, making it valuable in drug development and other fine chemical processes.
CAS Number | 329944-72-1 |
Synonyms | 1-Bromo-3-chloro-5-methylbenzene; 3-Chloro-5-methyl-bromobenzene; |
Molecular Formula | C7H6BrCl |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | 1-bromo-3-chloro-5-methylbenzene |
InChI | InChI=1S/C7H6BrCl/c1-5-2-6(8)4-7(9)3-5/h2-4H,1H3 |
InChIKey | YRIKDGJWRMHTJP-UHFFFAOYSA-N |
SMILES | CC1=CC(=CC(=C1)Br)Cl |