For research use only. Not for therapeutic Use.
3-Bromo-5-fluoro-4-hydroxybenzaldehyde is an aromatic compound characterized by a benzaldehyde core substituted with bromine, fluorine, and hydroxyl groups. Positioned on the benzene ring, these substituents modulate the compound’s reactivity, with the electron-withdrawing bromine and fluorine atoms enhancing its stability, while the hydroxyl group adds polarity and potential for hydrogen bonding. This compound is useful in organic synthesis as a building block, particularly in medicinal and materials chemistry, enabling the creation of complex molecules with specific functional properties.
CAS Number | 185345-46-4 |
Synonyms | 3-broMo-5-fluoro-4-hydroxybenzaldehyde |
Molecular Formula | C7H4BrFO2 |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | 3-bromo-5-fluoro-4-hydroxybenzaldehyde |
InChI | InChI=1S/C7H4BrFO2/c8-5-1-4(3-10)2-6(9)7(5)11/h1-3,11H |
InChIKey | FSLFKQZWBRMALB-UHFFFAOYSA-N |
SMILES | C1=C(C=C(C(=C1F)O)Br)C=O |