For research use only. Not for therapeutic Use.
3-Bromo-5-fluorobenzene-1-sulfonyl chloride(CAT: L012168) is a halogenated aromatic sulfonyl chloride compound featuring bromine and fluorine substitutions at the 3- and 5-positions, respectively. This versatile reagent is widely used in pharmaceutical and chemical research as a key intermediate for synthesizing sulfonamides, sulfonylureas, and other bioactive molecules. Its reactive sulfonyl chloride group enables facile coupling with amines and alcohols, making it valuable for medicinal chemistry and materials science applications. With high purity and reliability, 3-Bromo-5-fluorobenzene-1-sulfonyl chloride is an essential building block for advanced organic synthesis and innovative drug discovery projects.
CAS Number | 1214342-44-5 |
Molecular Formula | C6H3BrClFO2S |
Purity | ≥95% |
IUPAC Name | 3-bromo-5-fluorobenzenesulfonyl chloride |
InChI | InChI=1S/C6H3BrClFO2S/c7-4-1-5(9)3-6(2-4)12(8,10)11/h1-3H |
InChIKey | HZJBQCUMWMMHMK-UHFFFAOYSA-N |
SMILES | C1=C(C=C(C=C1S(=O)(=O)Cl)Br)F |