For research use only. Not for therapeutic Use.
3-Bromo-5-fluorobenzoic acid is an aromatic carboxylic acid characterized by a benzene ring with bromine at the 3-position and fluorine at the 5-position. This compound exhibits unique electronic properties due to the presence of both halogens, which can influence its reactivity in organic reactions. It serves as a valuable intermediate in organic synthesis, particularly in the development of pharmaceuticals and agrochemicals. The carboxylic acid functionality allows for various modifications, enabling further exploration of structure-activity relationships in chemical research.
CAS Number | 176548-70-2 |
Molecular Formula | C7H4BrFO2 |
Purity | ≥95% |
IUPAC Name | 3-bromo-5-fluorobenzoic acid |
InChI | InChI=1S/C7H4BrFO2/c8-5-1-4(7(10)11)2-6(9)3-5/h1-3H,(H,10,11) |
InChIKey | KLSLJMGWUPAQGZ-UHFFFAOYSA-N |
SMILES | C1=C(C=C(C=C1F)Br)C(=O)O |