For research use only. Not for therapeutic Use.
3-Bromo-5-fluoropicolinonitrile(CAT: L040722) is a high-purity heterocyclic compound featuring a bromine atom, a fluorine atom, and a nitrile group on a pyridine ring. This versatile molecule is widely used as an intermediate in pharmaceutical and agrochemical research, particularly in the synthesis of bioactive compounds. Its unique structure allows for diverse functionalization, making it valuable for designing enzyme inhibitors, receptor modulators, and specialty chemicals. With excellent stability and reactivity, 3-Bromo-5-fluoropicolinonitrile is a reliable building block for advanced research in medicinal chemistry, material science, and fine chemical production.
CAS Number | 950670-18-5 |
Molecular Formula | C6H2BrFN2 |
Purity | ≥95% |
IUPAC Name | 3-bromo-5-fluoropyridine-2-carbonitrile |
InChI | InChI=1S/C6H2BrFN2/c7-5-1-4(8)3-10-6(5)2-9/h1,3H |
InChIKey | OLOSREGULYFXDD-UHFFFAOYSA-N |
SMILES | C1=C(C=NC(=C1Br)C#N)F |