For research use only. Not for therapeutic Use.
3-Bromo-5-iodopyrazin-2-amine is an organic compound characterized by a pyrazine ring with a bromine atom at the third position and an iodine atom at the fifth position, along with an amino group (-NH₂) at the second position. Its chemical formula is C₄H₄BrI₁N₃. This compound is of interest in medicinal chemistry due to its potential biological activities, including antimicrobial and anticancer properties. The halogen substituents enhance its reactivity, making it a valuable intermediate for the synthesis of various bioactive molecules.
| Catalog Number | L031945 |
| CAS Number | 1449112-32-6 |
| Molecular Formula | C4H3BrIN3 |
| Purity | ≥95% |
| IUPAC Name | 3-bromo-5-iodopyrazin-2-amine |
| InChI | InChI=1S/C4H3BrIN3/c5-3-4(7)8-1-2(6)9-3/h1H,(H2,7,8) |
| InChIKey | GEJKBRAHGRAHJU-UHFFFAOYSA-N |
| SMILES | C1=C(N=C(C(=N1)N)Br)I |
