For research use only. Not for therapeutic Use.
3-Bromo-5-iodopyridin-4-amine(CAT: L016491) is a high-purity heterocyclic compound widely employed in pharmaceutical and chemical research. Featuring bromine and iodine substituents on a pyridine ring with an amine group at the 4-position, it serves as a versatile intermediate for synthesizing complex organic molecules, including bioactive compounds and advanced materials. Its halogenated structure facilitates diverse chemical transformations, such as cross-coupling reactions and nucleophilic substitutions. With reliable reactivity and consistent performance, 3-Bromo-5-iodopyridin-4-amine is an essential building block for advancing medicinal chemistry and innovative synthetic applications.
CAS Number | 902837-39-2 |
Molecular Formula | C5H4BrIN2 |
Purity | ≥95% |
IUPAC Name | 3-bromo-5-iodopyridin-4-amine |
InChI | InChI=1S/C5H4BrIN2/c6-3-1-9-2-4(7)5(3)8/h1-2H,(H2,8,9) |
InChIKey | OGUAUXDOIHVFPA-UHFFFAOYSA-N |
SMILES | C1=C(C(=C(C=N1)I)N)Br |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |