For research use only. Not for therapeutic Use.
3-Bromo-5-isopropoxypyridine(Cat No.:L006810). It features a pyridine ring substituted with a bromine atom at the 3-position and an isopropoxy group (-OCH(CH3)2) at the 5-position. This compound is important in organic synthesis, serving as a key intermediate for creating various organic molecules, including pharmaceuticals and agrochemicals. Its unique structure allows for diverse chemical transformations, making it valuable in the design and synthesis of complex molecules. Researchers use it as a versatile building block, contributing to advancements in drug discovery, materials science, and the development of specialized organic compounds.
CAS Number | 212332-40-6 |
Molecular Formula | C8H10BrNO |
Purity | ≥95% |
Storage | Room Temperature |
IUPAC Name | 3-bromo-5-propan-2-yloxypyridine |
InChI | InChI=1S/C8H10BrNO/c1-6(2)11-8-3-7(9)4-10-5-8/h3-6H,1-2H3 |
InChIKey | ASEHPOZWQJRWAD-UHFFFAOYSA-N |
SMILES | CC(C)OC1=CC(=CN=C1)Br |