For research use only. Not for therapeutic Use.
3-Bromo-5-nitropicolinonitrile(Cat No.:L019509)is a halogenated pyridine derivative featuring a bromine atom at the 3-position, a nitro group at the 5-position, and a nitrile group on the picoline ring. This compound is important in pharmaceutical research and organic synthesis as an intermediate in the development of bioactive molecules, particularly in the creation of drugs and agrochemicals. The combination of bromine and nitro groups allows for versatile chemical modifications, making it useful in constructing complex molecular frameworks. High purity ensures its effectiveness in advanced research and chemical development applications.
CAS Number | 573762-54-6 |
Molecular Formula | C6H2BrN3O2 |
Purity | ≥95% |
IUPAC Name | 3-bromo-5-nitropyridine-2-carbonitrile |
InChI | InChI=1S/C6H2BrN3O2/c7-5-1-4(10(11)12)3-9-6(5)2-8/h1,3H |
InChIKey | VAGVLGKIIQGBFU-UHFFFAOYSA-N |
SMILES | C1=C(C=NC(=C1Br)C#N)[N+](=O)[O-] |