For research use only. Not for therapeutic Use.
3-Bromo-5-phenyl-1,2,4-oxadiazole(Cat No.:L015074)is a heterocyclic compound featuring a bromine atom at the 3-position and a phenyl group at the 5-position on an oxadiazole ring. This compound is valuable in pharmaceutical research and organic synthesis as a building block for developing bioactive molecules, including potential drug candidates and agrochemicals. The bromine atom allows for further functionalization through cross-coupling reactions, while the oxadiazole ring provides unique electronic properties. Its high purity and reactivity make it essential for advanced research in medicinal chemistry and chemical synthesis.
CAS Number | 23432-94-2 |
Molecular Formula | C8H5BrN2O |
Purity | ≥95% |
IUPAC Name | 3-bromo-5-phenyl-1,2,4-oxadiazole |
InChI | InChI=1S/C8H5BrN2O/c9-8-10-7(12-11-8)6-4-2-1-3-5-6/h1-5H |
InChIKey | WJLDWMUZNIQXET-UHFFFAOYSA-N |
SMILES | C1=CC=C(C=C1)C2=NC(=NO2)Br |