For research use only. Not for therapeutic Use.
3-bromo-5-phenyl Salicylic Acid(CAT: I011780) is a chemical compound that belongs to the class of salicylic acid derivatives. It contains a phenyl ring and a bromine atom in addition to the salicylic acid moiety. 3-bromo-5-phenyl salicylic acid has been studied for its potential pharmaceutical applications, particularly as an anti-inflammatory and analgesic agent. Salicylic acid derivatives, including aspirin, are widely used as pain relievers and fever reducers due to their ability to inhibit the enzyme cyclooxygenase (COX), which is involved in the production of prostaglandins that contribute to inflammation and pain.
CAS Number | 4906-68-7 |
Synonyms | 5-bromo-4-hydroxy-[1,1/’-biphenyl]-3-carboxylic acid |
Molecular Formula | C13H9BrO3 |
Purity | ≥95% |
Target | Reductases |
Solubility | Soluble in DMSO |
Storage | Store at -20°C |
IUPAC Name | 3-bromo-2-hydroxy-5-phenylbenzoic acid |
InChI | InChI=1S/C13H9BrO3/c14-11-7-9(8-4-2-1-3-5-8)6-10(12(11)15)13(16)17/h1-7,15H,(H,16,17) |
InChIKey | XVZSXNULHSIRCQ-UHFFFAOYSA-N |
SMILES | C1=CC=C(C=C1)C2=CC(=C(C(=C2)Br)O)C(=O)O |